CAS 1077-94-7 appears in our catalog under these names: 5-Bromo-1H-indazole-3-carboxylic acid, 95% , 5-Bromo-1H-indazole-3-carboxylic acid, 97%, 97%, 5-Bromo-1H-indazole-3-carboxylic acid, 95%, 5-Bromoindazole-3-carboxylic acid, 97%. Offered by: Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 250MG, 1g, 5g, 10g, 25g, 100g, 500g.
5-bromo-1H-indazole-3-carboxylic acid (CAS 1077-94-7) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 5-bromo-1H-indazole-3-carboxylic acid. InChIKey: AMJVXOOGGBPVCZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-bromo-1H-indazole-3-carboxylic acid |
| InChIKey | AMJVXOOGGBPVCZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)