CAS 107746-52-1 is the registry number for E-5110. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-methoxypyrrolidin-2-one (CAS 107746-52-1) is a chemical compound with the molecular formula C20H29NO3 and a molecular weight of 331.4 g/mol. IUPAC name: (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-methoxypyrrolidin-2-one. InChIKey: NJTQENWDJVHUOX-GXDHUFHOSA-N.
| Molecular formula | C20H29NO3 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-methoxypyrrolidin-2-one |
| InChIKey | NJTQENWDJVHUOX-GXDHUFHOSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C/2\CCN(C2=O)OC |
Computed by PubChem (NCBI)