Products 126456-06-2
CAS 126456-06-2 is the registry number for ADDA. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3S,4E,6E,8S,9S)-3-amino-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoic acid (CAS 126456-06-2) is a chemical compound with the molecular formula C20H29NO3 and a molecular weight of 331.4 g/mol. IUPAC name: (2S,3S,4E,6E,8S,9S)-3-amino-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoic acid. InChIKey: HJVCHYDYCYBBQX-HLTLHRPFSA-N.
| Molecular formula | C20H29NO3 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (2S,3S,4E,6E,8S,9S)-3-amino-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoic acid |
| InChIKey | HJVCHYDYCYBBQX-HLTLHRPFSA-N |
| SMILES | C[C@@H](/C=C(\C)/C=C/[C@@H]([C@H](C)C(=O)O)N)[C@H](CC1=CC=CC=C1)OC |
Computed by PubChem (NCBI)