Products 107756-67-2
CAS 107756-67-2 is the registry number for N-(5-Cyano-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(5-cyano-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (CAS 107756-67-2) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: N-(5-cyano-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide. InChIKey: ZDZWHUBLDZGZGV-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | N-(5-cyano-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| InChIKey | ZDZWHUBLDZGZGV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=C(C=C1)C(CCC2)C#N |
Computed by PubChem (NCBI)