CAS 1078162-90-9 appears in our catalog under these names: N-Phenylpyrrolidine-2-carboxamide hydrochloride, 98+%, N-Phenylpyrrolidine-2-carboxamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-phenylpyrrolidine-2-carboxamide;hydrochloride (CAS 1078162-90-9) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: N-phenylpyrrolidine-2-carboxamide;hydrochloride. InChIKey: QULLGQCXQHTTTF-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | N-phenylpyrrolidine-2-carboxamide;hydrochloride |
| InChIKey | QULLGQCXQHTTTF-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C(=O)NC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)