CAS 1078163-26-4 is the registry number for N-(3,5-Difluorophenyl)piperidine-2-carboxamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(3,5-difluorophenyl)piperidine-2-carboxamide;hydrochloride (CAS 1078163-26-4) is a chemical compound with the molecular formula C12H15ClF2N2O and a molecular weight of 276.71 g/mol. IUPAC name: N-(3,5-difluorophenyl)piperidine-2-carboxamide;hydrochloride. InChIKey: KXMGRSDBEPJPIW-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF2N2O |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | N-(3,5-difluorophenyl)piperidine-2-carboxamide;hydrochloride |
| InChIKey | KXMGRSDBEPJPIW-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C(=O)NC2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)