Products 1588863-13-1
CAS 1588863-13-1 is the registry number for (1,4-Diazepan-1-yl)(2,5-difluorophenyl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-diazepan-1-yl-(2,5-difluorophenyl)methanone;hydrochloride (CAS 1588863-13-1) is a chemical compound with the molecular formula C12H15ClF2N2O and a molecular weight of 276.71 g/mol. IUPAC name: 1,4-diazepan-1-yl-(2,5-difluorophenyl)methanone;hydrochloride. InChIKey: PRZYAPJZGHNJKW-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF2N2O |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | 1,4-diazepan-1-yl-(2,5-difluorophenyl)methanone;hydrochloride |
| InChIKey | PRZYAPJZGHNJKW-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)C2=C(C=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)