CAS 84163-46-2 is the registry number for Risperidone Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.
(NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine;hydrochloride (CAS 84163-46-2) is a chemical compound with the molecular formula C12H15ClF2N2O and a molecular weight of 276.71 g/mol. IUPAC name: (NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine;hydrochloride. InChIKey: CPVWKXXFKMUDPA-CLNHMMGSSA-N.
| Molecular formula | C12H15ClF2N2O |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | (NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine;hydrochloride |
| InChIKey | CPVWKXXFKMUDPA-CLNHMMGSSA-N |
| SMILES | C1CNCCC1/C(=N\O)/C2=C(C=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)