Products 1833853-40-9
CAS 1833853-40-9 is the registry number for (3,4-Difluorophenyl)(3-methylpiperazin-1-yl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,4-difluorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride (CAS 1833853-40-9) is a chemical compound with the molecular formula C12H15ClF2N2O and a molecular weight of 276.71 g/mol. IUPAC name: (3,4-difluorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride. InChIKey: HAIXYRDPCFQLTC-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF2N2O |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | (3,4-difluorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride |
| InChIKey | HAIXYRDPCFQLTC-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1)C(=O)C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)