CAS 1078610-94-2 appears in our catalog under these names: 2,3,4,6-Tetrafluorobenzylamine hydrochloride, 95%, 2,3,4,6-Tetrafluorobenzylamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g.
(2,3,4,6-tetrafluorophenyl)methanamine;hydrochloride (CAS 1078610-94-2) is a chemical compound with the molecular formula C7H6ClF4N and a molecular weight of 215.57 g/mol. IUPAC name: (2,3,4,6-tetrafluorophenyl)methanamine;hydrochloride. InChIKey: RKRRFXPJXNNWGE-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF4N |
|---|---|
| Molecular weight | 215.57 g/mol |
| IUPAC name | (2,3,4,6-tetrafluorophenyl)methanamine;hydrochloride |
| InChIKey | RKRRFXPJXNNWGE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)CN)F.Cl |
Computed by PubChem (NCBI)