CAS 158388-51-3 is the registry number for (2,3,5,6-Tetrafluorophenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2,3,5,6-tetrafluorophenyl)methanamine;hydrochloride (CAS 158388-51-3) is a chemical compound with the molecular formula C7H6ClF4N and a molecular weight of 215.57 g/mol. IUPAC name: (2,3,5,6-tetrafluorophenyl)methanamine;hydrochloride. InChIKey: ROEXYUJGMYZFMY-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF4N |
|---|---|
| Molecular weight | 215.57 g/mol |
| IUPAC name | (2,3,5,6-tetrafluorophenyl)methanamine;hydrochloride |
| InChIKey | ROEXYUJGMYZFMY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)CN)F)F.Cl |
Computed by PubChem (NCBI)