CAS 2171899-10-6 is the registry number for 3-(Difluoromethyl)-4,5-difluoroaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(difluoromethyl)-4,5-difluoroaniline;hydrochloride (CAS 2171899-10-6) is a chemical compound with the molecular formula C7H6ClF4N and a molecular weight of 215.57 g/mol. IUPAC name: 3-(difluoromethyl)-4,5-difluoroaniline;hydrochloride. InChIKey: FLYSBUNLBJNKBV-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF4N |
|---|---|
| Molecular weight | 215.57 g/mol |
| IUPAC name | 3-(difluoromethyl)-4,5-difluoroaniline;hydrochloride |
| InChIKey | FLYSBUNLBJNKBV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)F)F)F)N.Cl |
Computed by PubChem (NCBI)