CAS 139185-13-0 appears in our catalog under these names: 4-Fluoro-3-(trifluoromethyl)aniline hydrochloride, 98%, 98%, 4-Fluoro-3-(trifluoromethyl)aniline hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 1g.
4-fluoro-3-(trifluoromethyl)aniline;hydrochloride (CAS 139185-13-0) is a chemical compound with the molecular formula C7H6ClF4N and a molecular weight of 215.57 g/mol. IUPAC name: 4-fluoro-3-(trifluoromethyl)aniline;hydrochloride. InChIKey: SKVPBPQAJUKHFJ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF4N |
|---|---|
| Molecular weight | 215.57 g/mol |
| IUPAC name | 4-fluoro-3-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | SKVPBPQAJUKHFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)F.Cl |
Computed by PubChem (NCBI)