CAS 1078627-77-6 is the registry number for 2,6-Dichloropyridine-3-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,6-dichloropyridine-3-sulfonamide (CAS 1078627-77-6) is a chemical compound with the molecular formula C5H4Cl2N2O2S and a molecular weight of 227.07 g/mol. IUPAC name: 2,6-dichloropyridine-3-sulfonamide. InChIKey: SJBIXZKLHHLQIU-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl2N2O2S |
|---|---|
| Molecular weight | 227.07 g/mol |
| IUPAC name | 2,6-dichloropyridine-3-sulfonamide |
| InChIKey | SJBIXZKLHHLQIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1S(=O)(=O)N)Cl)Cl |
Computed by PubChem (NCBI)