CAS 1803805-58-4 is the registry number for 4,5-Dichloro-2-(methylsulfonyl)pyrimidine, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4,5-dichloro-2-methylsulfonylpyrimidine (CAS 1803805-58-4) is a chemical compound with the molecular formula C5H4Cl2N2O2S and a molecular weight of 227.07 g/mol. IUPAC name: 4,5-dichloro-2-methylsulfonylpyrimidine. InChIKey: KMFAWGFSESRBPG-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl2N2O2S |
|---|---|
| Molecular weight | 227.07 g/mol |
| IUPAC name | 4,5-dichloro-2-methylsulfonylpyrimidine |
| InChIKey | KMFAWGFSESRBPG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C(C(=N1)Cl)Cl |
Computed by PubChem (NCBI)