Products 514842-56-9
CAS 514842-56-9 appears in our catalog under these names: 2,4-Dichloro-5-(methylsulfonyl)pyrimidine, 95%, 95%, 2,4-Dichloro-5-(methylsulfonyl)pyrimidine, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-dichloro-5-methylsulfonylpyrimidine (CAS 514842-56-9) is a chemical compound with the molecular formula C5H4Cl2N2O2S and a molecular weight of 227.07 g/mol. IUPAC name: 2,4-dichloro-5-methylsulfonylpyrimidine. InChIKey: AIBQMCGVTXVLJE-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl2N2O2S |
|---|---|
| Molecular weight | 227.07 g/mol |
| IUPAC name | 2,4-dichloro-5-methylsulfonylpyrimidine |
| InChIKey | AIBQMCGVTXVLJE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CN=C(N=C1Cl)Cl |
Computed by PubChem (NCBI)