CAS 1352508-08-7 is the registry number for 4,5-Dichloropyridine-3-sulfonamide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4,5-dichloropyridine-3-sulfonamide (CAS 1352508-08-7) is a chemical compound with the molecular formula C5H4Cl2N2O2S and a molecular weight of 227.07 g/mol. IUPAC name: 4,5-dichloropyridine-3-sulfonamide. InChIKey: MOMCWONXZCWUOB-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl2N2O2S |
|---|---|
| Molecular weight | 227.07 g/mol |
| IUPAC name | 4,5-dichloropyridine-3-sulfonamide |
| InChIKey | MOMCWONXZCWUOB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)