CAS 1078627-81-2 appears in our catalog under these names: (3,4-Dimethylphenyl)methanesulfonamide, 95%, (3,4-Dimethylphenyl)methanesulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
(3,4-dimethylphenyl)methanesulfonamide (CAS 1078627-81-2) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: (3,4-dimethylphenyl)methanesulfonamide. InChIKey: FNZVMYIPUKLUEJ-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | (3,4-dimethylphenyl)methanesulfonamide |
| InChIKey | FNZVMYIPUKLUEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CS(=O)(=O)N)C |
Computed by PubChem (NCBI)