CAS 1079221-49-0 is the registry number for Imexine FAM. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 500mg.
2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride (CAS 1079221-49-0) is a chemical compound with the molecular formula C9H12ClN3O2 and a molecular weight of 229.66 g/mol. IUPAC name: 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride. InChIKey: HFFCVKYVJNYQLA-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O2 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride |
| InChIKey | HFFCVKYVJNYQLA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NN2C=C1)OCCO)N.Cl |
Computed by PubChem (NCBI)