Products 2525094-56-6

CAS 2525094-56-6 is the registry number for Methyl 2-(1-aminocyclopropyl)pyrimidine-5-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-(1-aminocyclopropyl)pyrimidine-5-carboxylate;hydrochloride (CAS 2525094-56-6) is a chemical compound with the molecular formula C9H12ClN3O2 and a molecular weight of 229.66 g/mol. IUPAC name: methyl 2-(1-aminocyclopropyl)pyrimidine-5-carboxylate;hydrochloride. InChIKey: OLSCIKYGAYELHM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClN3O2
Molecular weight229.66 g/mol
IUPAC namemethyl 2-(1-aminocyclopropyl)pyrimidine-5-carboxylate;hydrochloride
InChIKeyOLSCIKYGAYELHM-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN=C(N=C1)C2(CC2)N.Cl

Computed by PubChem (NCBI)