CAS 2525094-56-6 is the registry number for Methyl 2-(1-aminocyclopropyl)pyrimidine-5-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(1-aminocyclopropyl)pyrimidine-5-carboxylate;hydrochloride (CAS 2525094-56-6) is a chemical compound with the molecular formula C9H12ClN3O2 and a molecular weight of 229.66 g/mol. IUPAC name: methyl 2-(1-aminocyclopropyl)pyrimidine-5-carboxylate;hydrochloride. InChIKey: OLSCIKYGAYELHM-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O2 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | methyl 2-(1-aminocyclopropyl)pyrimidine-5-carboxylate;hydrochloride |
| InChIKey | OLSCIKYGAYELHM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(N=C1)C2(CC2)N.Cl |
Computed by PubChem (NCBI)