Products 112677-03-9
CAS 112677-03-9 appears in our catalog under these names: Methyl 4-carbamimidamidobenzoate hydrochloride, 95%, Methyl 4-carbamimidamidobenzoate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Methyl 4-(diaminomethylideneamino)benzoate;hydrochloride (CAS 112677-03-9) is a chemical compound with the molecular formula C9H12ClN3O2 and a molecular weight of 229.66 g/mol. IUPAC name: methyl 4-(diaminomethylideneamino)benzoate;hydrochloride. InChIKey: SXWBLVFGECGROC-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O2 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | methyl 4-(diaminomethylideneamino)benzoate;hydrochloride |
| InChIKey | SXWBLVFGECGROC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)N=C(N)N.Cl |
Computed by PubChem (NCBI)