CAS 300668-01-3 appears in our catalog under these names: N-(2-Chloro-4-nitrophenyl)propane-1,3-diamine, 95%, N1-(2-Chloro-4-nitrophenyl)propane-1,3-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N'-(2-chloro-4-nitrophenyl)propane-1,3-diamine (CAS 300668-01-3) is a chemical compound with the molecular formula C9H12ClN3O2 and a molecular weight of 229.66 g/mol. IUPAC name: N'-(2-chloro-4-nitrophenyl)propane-1,3-diamine. InChIKey: SMLZMZSLFAGBLG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O2 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | N'-(2-chloro-4-nitrophenyl)propane-1,3-diamine |
| InChIKey | SMLZMZSLFAGBLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NCCCN |
Computed by PubChem (NCBI)