CAS 1079774-32-5 is the registry number for Agomelatine Impurity 65. Offered by: Chemat Brand. Available pack sizes: on request.
2-(7-hydroxynaphthalen-1-yl)acetonitrile (CAS 1079774-32-5) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 2-(7-hydroxynaphthalen-1-yl)acetonitrile. InChIKey: HIJPGWKHVWYNRF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 2-(7-hydroxynaphthalen-1-yl)acetonitrile |
| InChIKey | HIJPGWKHVWYNRF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)O)C(=C1)CC#N |
Computed by PubChem (NCBI)