Products 1081115-59-4
CAS 1081115-59-4 is the registry number for 1-(4-Cyano-2-methyl-1,3-oxazol-5-yl)piperidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-cyano-2-methyl-1,3-oxazol-5-yl)piperidine-4-carboxylic acid (CAS 1081115-59-4) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: 1-(4-cyano-2-methyl-1,3-oxazol-5-yl)piperidine-4-carboxylic acid. InChIKey: SDPFWQCYDIGLMG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 1-(4-cyano-2-methyl-1,3-oxazol-5-yl)piperidine-4-carboxylic acid |
| InChIKey | SDPFWQCYDIGLMG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)N2CCC(CC2)C(=O)O)C#N |
Computed by PubChem (NCBI)