Products 1082066-52-1
CAS 1082066-52-1 appears in our catalog under these names: (3-Fluoro-4-(hydroxymethyl)phenyl)boronic acid, 97%, (3-Fluoro-4-(hydroxymethyl)phenyl)boronic acid, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
[3-fluoro-4-(hydroxymethyl)phenyl]boronic acid (CAS 1082066-52-1) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: [3-fluoro-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: ZAGFMKDDCAZZOI-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [3-fluoro-4-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | ZAGFMKDDCAZZOI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CO)F)(O)O |
Computed by PubChem (NCBI)