Products 1082077-07-3

CAS 1082077-07-3 is the registry number for Pregabalin Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3S)-3-(2-ethoxy-2-oxoethyl)-5-methylhexanoic acid (CAS 1082077-07-3) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: (3S)-3-(2-ethoxy-2-oxoethyl)-5-methylhexanoic acid. InChIKey: AITPVFXFEDSQBB-VIFPVBQESA-N.

Identity
Molecular formulaC11H20O4
Molecular weight216.27 g/mol
IUPAC name(3S)-3-(2-ethoxy-2-oxoethyl)-5-methylhexanoic acid
InChIKeyAITPVFXFEDSQBB-VIFPVBQESA-N
SMILESCCOC(=O)C[C@@H](CC(C)C)CC(=O)O

Computed by PubChem (NCBI)