Products 1082279-37-5
CAS 1082279-37-5 appears in our catalog under these names: 1,1,3-Trioxo-2-(propan-2-yl)-2,3-dihydro-1,2-benzothiazole-6-carboxylic acid, 95%, 1,1,3-Trioxo-2-(propan-2-yl)-2,3-dihydro-1,2-benzothiazole-6-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carboxylic acid (CAS 1082279-37-5) is a chemical compound with the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. IUPAC name: 1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carboxylic acid. InChIKey: RSRMBVAPXVTDPW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5S |
|---|---|
| Molecular weight | 269.28 g/mol |
| IUPAC name | 1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carboxylic acid |
| InChIKey | RSRMBVAPXVTDPW-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=C(S1(=O)=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)