CAS 29209-30-1 is the registry number for Methyl 2-methyl-4-oxo-3,4-dihydro-2H-benzo[e][1,2]thiazine-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-methyl-1,1,4-trioxo-3H-1lambda6,2-benzothiazine-3-carboxylate (CAS 29209-30-1) is a chemical compound with the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. IUPAC name: methyl 2-methyl-1,1,4-trioxo-3H-1lambda6,2-benzothiazine-3-carboxylate. InChIKey: GIQCXAYKJYPPFK-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5S |
|---|---|
| Molecular weight | 269.28 g/mol |
| IUPAC name | methyl 2-methyl-1,1,4-trioxo-3H-1lambda6,2-benzothiazine-3-carboxylate |
| InChIKey | GIQCXAYKJYPPFK-UHFFFAOYSA-N |
| SMILES | CN1C(C(=O)C2=CC=CC=C2S1(=O)=O)C(=O)OC |
Computed by PubChem (NCBI)