CAS 22010-99-7 is the registry number for Methyl 3-(1,1-dioxido-3-oxo-1,2-benzisothiazol-2(3h)-yl)propanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate (CAS 22010-99-7) is a chemical compound with the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. IUPAC name: methyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate. InChIKey: IXYMMNCRSWJVPN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5S |
|---|---|
| Molecular weight | 269.28 g/mol |
| IUPAC name | methyl 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoate |
| InChIKey | IXYMMNCRSWJVPN-UHFFFAOYSA-N |
| SMILES | COC(=O)CCN1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)