CAS 1171774-48-3 is the registry number for 2,3,4,5-Tetrahydro-4-oxo-1,1-dioxide-1,5-benzothiazepine-3-acetic acid. Offered by: TRC. Available pack sizes: 500mg.
2-(1,1,4-trioxo-3,5-dihydro-2H-1lambda6,5-benzothiazepin-3-yl)acetic acid (CAS 1171774-48-3) is a chemical compound with the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. IUPAC name: 2-(1,1,4-trioxo-3,5-dihydro-2H-1lambda6,5-benzothiazepin-3-yl)acetic acid. InChIKey: MXELSJPFZXQRJS-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5S |
|---|---|
| Molecular weight | 269.28 g/mol |
| IUPAC name | 2-(1,1,4-trioxo-3,5-dihydro-2H-1lambda6,5-benzothiazepin-3-yl)acetic acid |
| InChIKey | MXELSJPFZXQRJS-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC2=CC=CC=C2S1(=O)=O)CC(=O)O |
Computed by PubChem (NCBI)