CAS 1082395-50-3 is the registry number for 2-(2-Methoxyethyl)-1,1,3-trioxo-2,3-dihydro-1,2-benzothiazole-6-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2-methoxyethyl)-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid (CAS 1082395-50-3) is a chemical compound with the molecular formula C11H11NO6S and a molecular weight of 285.28 g/mol. IUPAC name: 2-(2-methoxyethyl)-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid. InChIKey: VMUPEMWMZLYIDR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6S |
|---|---|
| Molecular weight | 285.28 g/mol |
| IUPAC name | 2-(2-methoxyethyl)-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid |
| InChIKey | VMUPEMWMZLYIDR-UHFFFAOYSA-N |
| SMILES | COCCN1C(=O)C2=C(S1(=O)=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)