Products 1448675-22-6

CAS 1448675-22-6 is the registry number for Methanesulfonic acid 2-(1,3-dioxo-1,3-dihydro-isoindol-2-yloxy)-ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(1,3-dioxoisoindol-2-yl)oxyethyl methanesulfonate (CAS 1448675-22-6) is a chemical compound with the molecular formula C11H11NO6S and a molecular weight of 285.28 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)oxyethyl methanesulfonate. InChIKey: IDHGAUQXGVVVNE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO6S
Molecular weight285.28 g/mol
IUPAC name2-(1,3-dioxoisoindol-2-yl)oxyethyl methanesulfonate
InChIKeyIDHGAUQXGVVVNE-UHFFFAOYSA-N
SMILESCS(=O)(=O)OCCON1C(=O)C2=CC=CC=C2C1=O

Computed by PubChem (NCBI)