Products 1105058-09-0

CAS 1105058-09-0 is the registry number for 3-((2-Oxooxolan-3-yl)sulfamoyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-[(2-oxooxolan-3-yl)sulfamoyl]benzoic acid (CAS 1105058-09-0) is a chemical compound with the molecular formula C11H11NO6S and a molecular weight of 285.28 g/mol. IUPAC name: 3-[(2-oxooxolan-3-yl)sulfamoyl]benzoic acid. InChIKey: NCANXPQBPYADOG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO6S
Molecular weight285.28 g/mol
IUPAC name3-[(2-oxooxolan-3-yl)sulfamoyl]benzoic acid
InChIKeyNCANXPQBPYADOG-UHFFFAOYSA-N
SMILESC1COC(=O)C1NS(=O)(=O)C2=CC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)