Products 1153234-47-9
CAS 1153234-47-9 appears in our catalog under these names: 2-((3-Methoxy-3-oxopropyl)sulfanyl)-5-nitrobenzoic acid, 95%, 2-((3-Methoxy-3-oxopropyl)sulfanyl)-5-nitrobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(3-methoxy-3-oxopropyl)sulfanyl-5-nitrobenzoic acid (CAS 1153234-47-9) is a chemical compound with the molecular formula C11H11NO6S and a molecular weight of 285.28 g/mol. IUPAC name: 2-(3-methoxy-3-oxopropyl)sulfanyl-5-nitrobenzoic acid. InChIKey: BCIFKXRNBNMXBH-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6S |
|---|---|
| Molecular weight | 285.28 g/mol |
| IUPAC name | 2-(3-methoxy-3-oxopropyl)sulfanyl-5-nitrobenzoic acid |
| InChIKey | BCIFKXRNBNMXBH-UHFFFAOYSA-N |
| SMILES | COC(=O)CCSC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)