CAS 1082681-41-1 is the registry number for rel-(1R,3R)-Cyclohexane-1,3-diamine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,3R)-cyclohexane-1,3-diamine;dihydrochloride (CAS 1082681-41-1) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: trans-(1R,3R)-cyclohexane-1,3-diamine;dihydrochloride. InChIKey: ABDGJCKNZHDDLV-BNTLRKBRSA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | trans-(1R,3R)-cyclohexane-1,3-diamine;dihydrochloride |
| InChIKey | ABDGJCKNZHDDLV-BNTLRKBRSA-N |
| SMILES | C1C[C@H](C[C@@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)