CAS 498532-32-4 appears in our catalog under these names: (1R,3S)-rel-Cyclohexane-1,3-diamine dihydrochloride, 97%, (1R,3S)–rel–Cyclohexane–1,3–diamine dihydrochloride, (1R,3S)-rel-Cyclohexane-1,3-diamine dihydrochloride, 95%, 95%, (1R,3S)-Cyclohexane-1,3-diamine dihydrochloride, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 10g, 1g, 100mg, 5g.
Cis-(1S,3R)-cyclohexane-1,3-diamine;dihydrochloride (CAS 498532-32-4) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: cis-(1S,3R)-cyclohexane-1,3-diamine;dihydrochloride. InChIKey: ABDGJCKNZHDDLV-RUTFAPCESA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | cis-(1S,3R)-cyclohexane-1,3-diamine;dihydrochloride |
| InChIKey | ABDGJCKNZHDDLV-RUTFAPCESA-N |
| SMILES | C1C[C@H](C[C@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)