CAS 860296-82-8 is the registry number for (1S,3S)-Cyclohexane-1,3-diamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Trans-(1S,3S)-cyclohexane-1,3-diamine;dihydrochloride (CAS 860296-82-8) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: trans-(1S,3S)-cyclohexane-1,3-diamine;dihydrochloride. InChIKey: ABDGJCKNZHDDLV-USPAICOZSA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | trans-(1S,3S)-cyclohexane-1,3-diamine;dihydrochloride |
| InChIKey | ABDGJCKNZHDDLV-USPAICOZSA-N |
| SMILES | C1C[C@@H](C[C@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)