CAS 1083224-10-5 appears in our catalog under these names: 5-(pyridin-3-yl)-1,3-oxazole-4-carboxylic acid, 5-(Pyridin-3-yl)oxazole-4-carboxylic acid, 95%, 95%, 5-(Pyridin-3-yl)oxazole-4-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
5-pyridin-3-yl-1,3-oxazole-4-carboxylic acid (CAS 1083224-10-5) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 5-pyridin-3-yl-1,3-oxazole-4-carboxylic acid. InChIKey: PKMQJMXWFIAFBO-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 5-pyridin-3-yl-1,3-oxazole-4-carboxylic acid |
| InChIKey | PKMQJMXWFIAFBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)