CAS 1084941-02-5 is the registry number for Methyl 5-methyl-2-(4-nitrophenyl)oxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-methyl-2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS 1084941-02-5) is a chemical compound with the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. IUPAC name: methyl 5-methyl-2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate. InChIKey: IUWNYCMIYYKAMM-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O5 |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | methyl 5-methyl-2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate |
| InChIKey | IUWNYCMIYYKAMM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=C(C=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)