CAS 108605-62-5 appears in our catalog under these names: A77 1726 (E/Z) Mixture, >95% (HPLC), Teriflunomide, 2-Cyano-3-hydroxy-N-(4-(trifluoromethyl)phenyl)but-2-enamide, (E/Z)-Teriflunomide 99+%, Teriflunomide(Random Configuration), 99+%, 99+%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 50mg, 10mg, 10mM (in 1ml dmso), 5g, 1mg, 25mg.
2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide (CAS 108605-62-5) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. IUPAC name: 2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide. InChIKey: UTNUDOFZCWSZMS-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2 |
|---|---|
| Molecular weight | 270.21 g/mol |
| IUPAC name | 2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide |
| InChIKey | UTNUDOFZCWSZMS-UHFFFAOYSA-N |
| SMILES | CC(=C(C#N)C(=O)NC1=CC=C(C=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)