CAS 1185240-22-5 appears in our catalog under these names: A77 1726-d4, >95% (HPLC), Teriflunomide-d4, >95% (HPLC), Teriflunomide–d4, Teriflunomide-d4, 99.98%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 1 mg.
(Z)-2-cyano-3-hydroxy-N-[2,3,5,6-tetradeuterio-4-(trifluoromethyl)phenyl]but-2-enamide (CAS 1185240-22-5) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 274.23 g/mol. IUPAC name: (Z)-2-cyano-3-hydroxy-N-[2,3,5,6-tetradeuterio-4-(trifluoromethyl)phenyl]but-2-enamide. InChIKey: UTNUDOFZCWSZMS-KXFGXCNQSA-N.
| Molecular formula | C12H9F3N2O2 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | (Z)-2-cyano-3-hydroxy-N-[2,3,5,6-tetradeuterio-4-(trifluoromethyl)phenyl]but-2-enamide |
| InChIKey | UTNUDOFZCWSZMS-KXFGXCNQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(F)(F)F)[2H])[2H])NC(=O)/C(=C(/C)\O)/C#N)[2H] |
Computed by PubChem (NCBI)