Products 108636-57-3
CAS 108636-57-3 is the registry number for (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 4-chlorobenzoate. Offered by: TRC. Available pack sizes: 1g.
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-chlorobenzoate (CAS 108636-57-3) is a chemical compound with the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. IUPAC name: (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-chlorobenzoate. InChIKey: QEHFNJVDZAVGEJ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO4 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-chlorobenzoate |
| InChIKey | QEHFNJVDZAVGEJ-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)COC(=O)C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)