CAS 1403577-55-8 is the registry number for Ethyl Ester-2-chloro-3-(3,4-dimethoxyphenyl)-2-propenoic Acid. Offered by: TRC. Available pack sizes: 2,5g.
Ethyl (Z)-2-chloro-3-(3,4-dimethoxyphenyl)prop-2-enoate (CAS 1403577-55-8) is a chemical compound with the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. IUPAC name: ethyl (Z)-2-chloro-3-(3,4-dimethoxyphenyl)prop-2-enoate. InChIKey: JVKKKFHHMCLLIL-YFHOEESVSA-N.
| Molecular formula | C13H15ClO4 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | ethyl (Z)-2-chloro-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| InChIKey | JVKKKFHHMCLLIL-YFHOEESVSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC(=C(C=C1)OC)OC)/Cl |
Computed by PubChem (NCBI)