Products 87343-61-1

CAS 87343-61-1 is the registry number for Benzyl chloromethyl pentanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-benzyl 5-O-(chloromethyl) pentanedioate (CAS 87343-61-1) is a chemical compound with the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. IUPAC name: 1-O-benzyl 5-O-(chloromethyl) pentanedioate. InChIKey: WBLPANGSHMDGIV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15ClO4
Molecular weight270.71 g/mol
IUPAC name1-O-benzyl 5-O-(chloromethyl) pentanedioate
InChIKeyWBLPANGSHMDGIV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)CCCC(=O)OCCl

Computed by PubChem (NCBI)