Products 93307-66-5

CAS 93307-66-5 is the registry number for 1,3-Diethyl 2-(3-chlorophenyl)propanedioate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Diethyl 2-(3-chlorophenyl)propanedioate (CAS 93307-66-5) is a chemical compound with the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. IUPAC name: diethyl 2-(3-chlorophenyl)propanedioate. InChIKey: IVLPRPZSLKVRGX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15ClO4
Molecular weight270.71 g/mol
IUPAC namediethyl 2-(3-chlorophenyl)propanedioate
InChIKeyIVLPRPZSLKVRGX-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CC(=CC=C1)Cl)C(=O)OCC

Computed by PubChem (NCBI)