Products 1086386-28-8
CAS 1086386-28-8 is the registry number for 7-benzyl-1,3-dimethyl-2,4-dioxo-2,3,4,7-tetrahydro-1h-pyrrolo(2,3-d)pyrimidine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1000mg.
7-benzyl-1,3-dimethyl-2,4-dioxopyrrolo[2,3-d]pyrimidine-6-carboxylic acid (CAS 1086386-28-8) is a chemical compound with the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. IUPAC name: 7-benzyl-1,3-dimethyl-2,4-dioxopyrrolo[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: SVWLLUUJATVFFE-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O4 |
|---|---|
| Molecular weight | 313.31 g/mol |
| IUPAC name | 7-benzyl-1,3-dimethyl-2,4-dioxopyrrolo[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | SVWLLUUJATVFFE-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(N2CC3=CC=CC=C3)C(=O)O)C(=O)N(C1=O)C |
Computed by PubChem (NCBI)