CAS 54824-17-8 appears in our catalog under these names: Mitonafide, Mitonafide/ 99.04% (existing batch purity), 2-[2-(Dimethylamino)ethyl]-5-nitro-1H-benz[de]isoquinoline-1,3(2H)-dione, 98%, 98%, Mitonafide (Standard), Mitonafide, 99.73%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 1mg, 2mg, 5mg, 50mg, 200mg.
2-[2-(dimethylamino)ethyl]-5-nitrobenzo[de]isoquinoline-1,3-dione (CAS 54824-17-8) is a chemical compound with the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. IUPAC name: 2-[2-(dimethylamino)ethyl]-5-nitrobenzo[de]isoquinoline-1,3-dione. InChIKey: XXVLKDRPHSFIIB-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O4 |
|---|---|
| Molecular weight | 313.31 g/mol |
| IUPAC name | 2-[2-(dimethylamino)ethyl]-5-nitrobenzo[de]isoquinoline-1,3-dione |
| InChIKey | XXVLKDRPHSFIIB-UHFFFAOYSA-N |
| SMILES | CN(C)CCN1C(=O)C2=CC=CC3=CC(=CC(=C32)C1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)