CAS 817172-49-9 appears in our catalog under these names: (2-Phenylimidazo(1,2-a)pyridin-3-yl)methanamine oxalate, 97%, C-(2-Phenyl-imidazo[1,2-a]pyridin-3-yl)-methylamine oxalate. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
Oxalic acid;(2-phenylimidazo[1,2-a]pyridin-3-yl)methanamine (CAS 817172-49-9) is a chemical compound with the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. IUPAC name: oxalic acid;(2-phenylimidazo[1,2-a]pyridin-3-yl)methanamine. InChIKey: LRYCRLLIJIACBE-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O4 |
|---|---|
| Molecular weight | 313.31 g/mol |
| IUPAC name | oxalic acid;(2-phenylimidazo[1,2-a]pyridin-3-yl)methanamine |
| InChIKey | LRYCRLLIJIACBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N3C=CC=CC3=N2)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)