Products 189352-49-6
CAS 189352-49-6 is the registry number for 5-[2-[4-(Dimethylamino)phenyl]diazenyl]-1,3-benzenedicarboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-[[4-(dimethylamino)phenyl]diazenyl]benzene-1,3-dicarboxylic acid (CAS 189352-49-6) is a chemical compound with the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. IUPAC name: 5-[[4-(dimethylamino)phenyl]diazenyl]benzene-1,3-dicarboxylic acid. InChIKey: NPZGKVAKUJCXMG-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O4 |
|---|---|
| Molecular weight | 313.31 g/mol |
| IUPAC name | 5-[[4-(dimethylamino)phenyl]diazenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | NPZGKVAKUJCXMG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)