Products 108641-82-3
CAS 108641-82-3 appears in our catalog under these names: DL–Homocystine–3,3,3',3',4,4,4',4'–d8, DL-Homocystine-3,3,3’,3’,4,4,4’,4’-d8, 98.0%, DL-Homocystine-3,3,3',3',4,4,4',4'-d8, >95% (HPLC), DL-Homocystine-3,3,3’,3’,4,4,4’,4’-d8, >95% (HPLC), DL-Homocystine-3,3,3',3',4,4,4',4'-d8, 98 atom % D, min 98% Chemical Purity. Offered by: GLPBio, MedChemExpress, TRC, CDN. Available pack sizes: 10mg, 100mg, 25mg, 50mg, 100 mg, 10 mg, 50 mg, 5 mg.
2-amino-4-[(3-amino-3-carboxy-1,1,2,2-tetradeuteriopropyl)disulfanyl]-3,3,4,4-tetradeuteriobutanoic acid (CAS 108641-82-3) is a chemical compound with the molecular formula C8H16N2O4S2 and a molecular weight of 276.4 g/mol. IUPAC name: 2-amino-4-[(3-amino-3-carboxy-1,1,2,2-tetradeuteriopropyl)disulfanyl]-3,3,4,4-tetradeuteriobutanoic acid. InChIKey: ZTVZLYBCZNMWCF-SVYQBANQSA-N.
| Molecular formula | C8H16N2O4S2 |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | 2-amino-4-[(3-amino-3-carboxy-1,1,2,2-tetradeuteriopropyl)disulfanyl]-3,3,4,4-tetradeuteriobutanoic acid |
| InChIKey | ZTVZLYBCZNMWCF-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C(C(=O)O)N)C([2H])([2H])SSC([2H])([2H])C([2H])([2H])C(C(=O)O)N |
Computed by PubChem (NCBI)